CAS 1423037-48-2 appears in our catalog under these names: (+/-)-Trans-4-(3-bromophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95%, (3R,4S)-rel-4-(3-Bromophenyl)pyrrolidine-3-carboxylic acid hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3R,4S)-4-(3-bromophenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1423037-48-2) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: (3R,4S)-4-(3-bromophenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: RIBXZLYDHCWZCF-UXQCFNEQSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | (3R,4S)-4-(3-bromophenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | RIBXZLYDHCWZCF-UXQCFNEQSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)