(3R,5S)-rel-3,5-Dimethylmorpholine hydrochloride, 98%
cas: 154596-17-5 — see every product listed under this CAS number, including other names
(3R,5S)-rel-3,5-Dimethylmorpholine hydrochloride, 98% (CAS 154596-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A775552-100mg |
| cas | 154596-17-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 509.44 Pln | |
| Ambeed | 5g | 2244.94 Pln | |
| Ambeed | 10g | 3552.12 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 497.63 Pln | |
| BLDpharm | 5g | 2202.58 Pln | |
| BLDpharm | 10g | 3485.46 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3S,5R)-3,5-dimethylmorpholine;hydrochloride (CAS 154596-17-5) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: (3S,5R)-3,5-dimethylmorpholine;hydrochloride. InChIKey: SBXQYCSQVMVHQR-KNCHESJLSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | (3S,5R)-3,5-dimethylmorpholine;hydrochloride |
| InChIKey | SBXQYCSQVMVHQR-KNCHESJLSA-N |
| SMILES | C[C@@H]1COC[C@@H](N1)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
Cis-3,5-dimethylmorpholine hydrochloride, (3R,5S)-rel-3,5-Dimethylmorpholine hydrochloride, (3r,5s)-3,5-dimethylmorpholine hydrochloride, cis-3,5-Dimethyl-morpholine HCl, cis-3,5-Dimethyl-morpholine hydrochloride, (3S,5R)-3,5-dimethylmorpholine;hydrochloride, (3S,5R)-3,5-dimethylmorpholine hydrochloride, cis-3,5-Dimethylmorpholine HCl, rel-(3R,5S)-3,5-Dimethylmorpholine hydrochloride, SBXQYCSQVMVHQR-KNCHESJLSA-N