CAS 154596-17-5 appears in our catalog under these names: cis-3,5-dimethyl-morpholine hcl, (3R,5S)-rel-3,5-Dimethylmorpholine hydrochloride 98%, (3R,5S)-rel-3,5-Dimethylmorpholine hydrochloride, 98%, 98%, (3R,5S)-rel-3,5-Dimethylmorpholine hydrochloride, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 500mg.
(3S,5R)-3,5-dimethylmorpholine;hydrochloride (CAS 154596-17-5) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: (3S,5R)-3,5-dimethylmorpholine;hydrochloride. InChIKey: SBXQYCSQVMVHQR-KNCHESJLSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | (3S,5R)-3,5-dimethylmorpholine;hydrochloride |
| InChIKey | SBXQYCSQVMVHQR-KNCHESJLSA-N |
| SMILES | C[C@@H]1COC[C@@H](N1)C.Cl |
Computed by PubChem (NCBI)