cas: 97538-67-5 — see every product listed under this CAS number, including other names
(3R,7aS)-3-(Trichloromethyl)tetrahydropyrrolo[1,2-c]oxazol-1(3H)-one, 98%, 98% (CAS 97538-67-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ZAO-1g |
| cas | 97538-67-5 |
| size | 1g |
| availability | 506.97g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 141.20 Pln | |
| Chemat | 25g | 261.20 Pln | |
| Chemat | 100g | 861.20 Pln | |
| Chemat | 50g | 462.80 Pln | |
| Chemat | 250g | 2061.20 Pln | |
| Chemat | 500g | 4132.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R,7aS)-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one (CAS 97538-67-5) is a chemical compound with the molecular formula C7H8Cl3NO2 and a molecular weight of 244.5 g/mol. IUPAC name: (3R,7aS)-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one. InChIKey: GWQBXRYSVSZLSL-UJURSFKZSA-N.
| Molecular formula | C7H8Cl3NO2 |
|---|---|
| Molecular weight | 244.5 g/mol |
| IUPAC name | (3R,7aS)-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one |
| InChIKey | GWQBXRYSVSZLSL-UJURSFKZSA-N |
| SMILES | C1C[C@H]2C(=O)O[C@@H](N2C1)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)