Products 77627-82-8
CAS 77627-82-8 appears in our catalog under these names: trans-N-(1E)-1,3-Butadien-1-yl-carbamic acid 2,2,2-trichloroethyl ester, 98% +(stabilized with TBC), trans-N-(1E)-1,3-Butadien-1-yl-carbamic Acid 2,2,2-Trichloroethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 500mg.
2,2,2-trichloroethyl N-[(1E)-buta-1,3-dienyl]carbamate (CAS 77627-82-8) is a chemical compound with the molecular formula C7H8Cl3NO2 and a molecular weight of 244.5 g/mol. IUPAC name: 2,2,2-trichloroethyl N-[(1E)-buta-1,3-dienyl]carbamate. InChIKey: NERUESRQTJURBD-ONEGZZNKSA-N.
| Molecular formula | C7H8Cl3NO2 |
|---|---|
| Molecular weight | 244.5 g/mol |
| IUPAC name | 2,2,2-trichloroethyl N-[(1E)-buta-1,3-dienyl]carbamate |
| InChIKey | NERUESRQTJURBD-ONEGZZNKSA-N |
| SMILES | C=C/C=C/NC(=O)OCC(Cl)(Cl)Cl |
Computed by PubChem (NCBI)