CAS 2381732-99-4 is the registry number for (3R,7Ar)-3-(trichloromethyl)tetrahydro-1h-pyrrolo[1,2-c][1,3]oxaz ol-1-one, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
(3R,7aR)-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one (CAS 2381732-99-4) is a chemical compound with the molecular formula C7H8Cl3NO2 and a molecular weight of 244.5 g/mol. IUPAC name: (3R,7aR)-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one. InChIKey: GWQBXRYSVSZLSL-INEUFUBQSA-N.
| Molecular formula | C7H8Cl3NO2 |
|---|---|
| Molecular weight | 244.5 g/mol |
| IUPAC name | (3R,7aR)-3-(trichloromethyl)-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c][1,3]oxazol-1-one |
| InChIKey | GWQBXRYSVSZLSL-INEUFUBQSA-N |
| SMILES | C1C[C@@H]2C(=O)O[C@@H](N2C1)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)