cas: 193693-66-2 — see every product listed under this CAS number, including other names
(3S)-Fmoc-1-pyrrolidine-3-carboxylic acid, 98.06% (CAS 193693-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 250 mg, 500 mg, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W151297-100 mg |
| cas | 193693-66-2 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 598.33 Pln | |
| MedChemExpress | 250 mg | 1053.44 Pln | |
| MedChemExpress | 500 mg | 1559.64 Pln | |
| MedChemExpress | 1 g | 2302.68 Pln | |
| MedChemExpress | 5 g | 6668.04 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.06% |
(3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 193693-66-2) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-ZDUSSCGKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-ZDUSSCGKSA-N |
| SMILES | C1CN(C[C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)