cas: 193693-66-2 — see every product listed under this CAS number, including other names
Fmoc-(3S)-1-Pyrrolidine-3-Carboxylic Acid, 95%, 95% (CAS 193693-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1185Z1-100mg |
| cas | 193693-66-2 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 1g | 1763.60 Pln | |
| Chemat | 5g | 7043.60 Pln | |
| Chemat | 10g | 7720.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 193693-66-2) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-ZDUSSCGKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-ZDUSSCGKSA-N |
| SMILES | C1CN(C[C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)