CAS 193693-66-2 appears in our catalog under these names: (3S)-Fmoc-1-pyrrolidine-3-carboxylic acid, 97%, Fmoc-L-β-Pro-OH 95%, (3S)-Fmoc-1-pyrrolidine-3-carboxylic acid, 98.06%, Fmoc-(3S)-1-Pyrrolidine-3-Carboxylic Acid, 95%, 95%, Fmoc-(3S)-b-Pro-OH, 95%. Offered by: Combi-blocks, Ambeed, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg, 100 mg, 250 mg, 500 mg, 1 g.
(3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 193693-66-2) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-ZDUSSCGKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-ZDUSSCGKSA-N |
| SMILES | C1CN(C[C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)