cas: 105812-81-5 — see every product listed under this CAS number, including other names
(3S,4R)-4-(4-Fluorophenyl)-3-hydroxymethyl-1-methylpiperidine, 97% (CAS 105812-81-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077690-5G |
| cas | 105812-81-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 100g | 674.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol (CAS 105812-81-5) is a chemical compound with the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. IUPAC name: [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol. InChIKey: CXRHUYYZISIIMT-AAEUAGOBSA-N.
| Molecular formula | C13H18FNO |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | [(3S,4R)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol |
| InChIKey | CXRHUYYZISIIMT-AAEUAGOBSA-N |
| SMILES | CN1CC[C@H]([C@@H](C1)CO)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)