Products 79606-44-3
CAS 79606-44-3 is the registry number for N,N-Diisopropyl-4-fluorobenzamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-fluoro-N,N-di(propan-2-yl)benzamide (CAS 79606-44-3) is a chemical compound with the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. IUPAC name: 4-fluoro-N,N-di(propan-2-yl)benzamide. InChIKey: ATALYWHBUWYPTA-UHFFFAOYSA-N.
| Molecular formula | C13H18FNO |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 4-fluoro-N,N-di(propan-2-yl)benzamide |
| InChIKey | ATALYWHBUWYPTA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)