CAS 100332-20-5 appears in our catalog under these names: Paroxetine Impurity 5, Paroxetine Impurity 58, Paroxetine Impurity 27. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(3S,4S)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol (CAS 100332-20-5) is a chemical compound with the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. IUPAC name: [(3S,4S)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol. InChIKey: CXRHUYYZISIIMT-WCQYABFASA-N.
| Molecular formula | C13H18FNO |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | [(3S,4S)-4-(4-fluorophenyl)-1-methylpiperidin-3-yl]methanol |
| InChIKey | CXRHUYYZISIIMT-WCQYABFASA-N |
| SMILES | CN1CC[C@@H]([C@@H](C1)CO)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)