cas: 24332-95-4 — see every product listed under this CAS number, including other names
(3S,4R,5R,6S)-6-Methyltetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate 95% (CAS 24332-95-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A764309-250mg |
| cas | 24332-95-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 948.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A764309 |
[(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate (CAS 24332-95-4) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate. InChIKey: QZQMGQQOGJIDKJ-DTYUZISYSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate |
| InChIKey | QZQMGQQOGJIDKJ-DTYUZISYSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)