CAS 5040-09-5 appears in our catalog under these names: 1,2,4,6-Tetra-O-acetyl-3-deoxy-D-glucopyranose, 98%, 3-Deoxy-1,2,4,6-tetra-O-acetyl-D-glucopyranose. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 500mg, 50mg.
[(2R,3S,5R)-3,5,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 5040-09-5) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2R,3S,5R)-3,5,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: TWQVUVQFUFLAHX-OANWKOAXSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2R,3S,5R)-3,5,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | TWQVUVQFUFLAHX-OANWKOAXSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C[C@H](C(O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)