CAS 306960-25-8 is the registry number for (3R,4R,5R)-5-(Acetoxymethyl)-3-methyltetrahydrofuran-2,3,4-triyl triacetate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4R)-3,4,5-triacetyloxy-4-methyloxolan-2-yl]methyl acetate (CAS 306960-25-8) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2R,3R,4R)-3,4,5-triacetyloxy-4-methyloxolan-2-yl]methyl acetate. InChIKey: RVXADQSOQHONLK-MVWAYNQESA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2R,3R,4R)-3,4,5-triacetyloxy-4-methyloxolan-2-yl]methyl acetate |
| InChIKey | RVXADQSOQHONLK-MVWAYNQESA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@](C(O1)OC(=O)C)(C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)