cas: 1279037-05-6 — see every product listed under this CAS number, including other names
(3S,4S)-3,4-DIFLUOROPYRROLIDINE HCL, 97% (CAS 1279037-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F539525-250MG |
| cas | 1279037-05-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1533.85 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S,4S)-3,4-difluoropyrrolidine;hydrochloride (CAS 1279037-05-6) is a chemical compound with the molecular formula C4H8ClF2N and a molecular weight of 143.56 g/mol. IUPAC name: (3S,4S)-3,4-difluoropyrrolidine;hydrochloride. InChIKey: JDUYOMPVOXGHIR-MMALYQPHSA-N.
| Molecular formula | C4H8ClF2N |
|---|---|
| Molecular weight | 143.56 g/mol |
| IUPAC name | (3S,4S)-3,4-difluoropyrrolidine;hydrochloride |
| InChIKey | JDUYOMPVOXGHIR-MMALYQPHSA-N |
| SMILES | C1[C@@H]([C@H](CN1)F)F.Cl |
Computed by PubChem (NCBI)