cas: 1279037-05-6 — see every product listed under this CAS number, including other names
Pyrrolidine, 3,4-difluoro-, hydrochloride (1:1), (3S,4S)-, 95%, 95% (CAS 1279037-05-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KASJ-100mg |
| cas | 1279037-05-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 947.60 Pln | |
| Chemat | 1g | 2190.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S,4S)-3,4-difluoropyrrolidine;hydrochloride (CAS 1279037-05-6) is a chemical compound with the molecular formula C4H8ClF2N and a molecular weight of 143.56 g/mol. IUPAC name: (3S,4S)-3,4-difluoropyrrolidine;hydrochloride. InChIKey: JDUYOMPVOXGHIR-MMALYQPHSA-N.
| Molecular formula | C4H8ClF2N |
|---|---|
| Molecular weight | 143.56 g/mol |
| IUPAC name | (3S,4S)-3,4-difluoropyrrolidine;hydrochloride |
| InChIKey | JDUYOMPVOXGHIR-MMALYQPHSA-N |
| SMILES | C1[C@@H]([C@H](CN1)F)F.Cl |
Computed by PubChem (NCBI)