(3S,4S)-4-fluoropyrrolidin-3-ol hydrochloride, 98%, 98%
cas: 1909293-52-2 — see every product listed under this CAS number, including other names
(3S,4S)-4-fluoropyrrolidin-3-ol hydrochloride, 98%, 98% (CAS 1909293-52-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EX6-100mg |
| cas | 1909293-52-2 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 500mg | 434.00 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 2392.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S,4S)-4-fluoropyrrolidin-3-ol;hydrochloride (CAS 1909293-52-2) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3S,4S)-4-fluoropyrrolidin-3-ol;hydrochloride. InChIKey: ZZJHCOUWDLIGPH-MMALYQPHSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3S,4S)-4-fluoropyrrolidin-3-ol;hydrochloride |
| InChIKey | ZZJHCOUWDLIGPH-MMALYQPHSA-N |
| SMILES | C1[C@@H]([C@H](CN1)F)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S,4S)-4-fluoropyrrolidin-3-ol hydrochloride, (3S,4S)-4-fluoropyrrolidin-3-ol;hydrochloride, trans-4-Fluoropyrrolidin-3-ol hydrochloride, cis-4-Fluoropyrrolidin-3-ol hydrochloride, (3R,4R)-4-Fluoro-3-hydroxypyrrolidine HCl, (3S,4S)-4-fluoropyrrolidin-3-ol HCl, (3S,4S)-4-Fluoro-3-hydroxypyrrolidine HCl, (3S,4S)-4-fluoropyrrolidin-3-olhydrochloride, (3S,4S)-4-Fluoro-3-hydroxypyrrolidine hydrochloride