cas: 1909293-52-2 — see every product listed under this CAS number, including other names
(3S,4S)-4-Fluoropyrrolidin-3-ol hydrochloride, 98% (CAS 1909293-52-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F614376-100MG |
| cas | 1909293-52-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 820.56 Pln | |
| Fluorochem | 5g | 3012.50 Pln | |
| Fluorochem | 10g | 5371.04 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S,4S)-4-fluoropyrrolidin-3-ol;hydrochloride (CAS 1909293-52-2) is a chemical compound with the molecular formula C4H9ClFNO and a molecular weight of 141.57 g/mol. IUPAC name: (3S,4S)-4-fluoropyrrolidin-3-ol;hydrochloride. InChIKey: ZZJHCOUWDLIGPH-MMALYQPHSA-N.
| Molecular formula | C4H9ClFNO |
|---|---|
| Molecular weight | 141.57 g/mol |
| IUPAC name | (3S,4S)-4-fluoropyrrolidin-3-ol;hydrochloride |
| InChIKey | ZZJHCOUWDLIGPH-MMALYQPHSA-N |
| SMILES | C1[C@@H]([C@H](CN1)F)O.Cl |
Computed by PubChem (NCBI)