(3S,6S)-3,6-Dimethyl-1,4-dioxane-2,5-dione, 97%
cas: 4511-42-6 — see every product listed under this CAS number, including other names
(3S,6S)-3,6-Dimethyl-1,4-dioxane-2,5-dione, 97% (CAS 4511-42-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A357015-1g |
| cas | 4511-42-6 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1360.50 Pln | |
| Ambeed | 1kg | 2200.44 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 25g | 219.95 Pln | |
| BLDpharm | 100g | 347.68 Pln | |
| BLDpharm | 500g | 1463.95 Pln | |
| BLDpharm | 1kg | 2369.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione (CAS 4511-42-6) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione. InChIKey: JJTUDXZGHPGLLC-IMJSIDKUSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | (3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione |
| InChIKey | JJTUDXZGHPGLLC-IMJSIDKUSA-N |
| SMILES | C[C@H]1C(=O)O[C@H](C(=O)O1)C |
Computed by PubChem (NCBI)
