Products 13076-17-0
CAS 13076-17-0 appears in our catalog under these names: D-Lactide, D(+)–LACTIDE, D(+)-LACTIDE/ 98%, D-Lactide, >98.0%(GC)(T), D(+)-LACTIDE 98%. Offered by: Chemat Brand, GLPBio, TargetMol, TCI, Ambeed. Available pack sizes: on request, 100g, 25g, 1g, 100mg, 500mg, 5g, 10g.
(3R,6R)-3,6-dimethyl-1,4-dioxane-2,5-dione (CAS 13076-17-0) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (3R,6R)-3,6-dimethyl-1,4-dioxane-2,5-dione. InChIKey: JJTUDXZGHPGLLC-QWWZWVQMSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | (3R,6R)-3,6-dimethyl-1,4-dioxane-2,5-dione |
| InChIKey | JJTUDXZGHPGLLC-QWWZWVQMSA-N |
| SMILES | C[C@@H]1C(=O)O[C@@H](C(=O)O1)C |
Computed by PubChem (NCBI)