CAS 2124278-99-3 is the registry number for L-(-)-Lactide-13C2. Offered by: TRC. Available pack sizes: 0,5mg, 5mg.
(3S,6S)-3,6-di((113C)methyl)-1,4-dioxane-2,5-dione (CAS 2124278-99-3) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 146.11 g/mol. IUPAC name: (3S,6S)-3,6-di((113C)methyl)-1,4-dioxane-2,5-dione. InChIKey: JJTUDXZGHPGLLC-IPSUFKGASA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 146.11 g/mol |
| IUPAC name | (3S,6S)-3,6-di((113C)methyl)-1,4-dioxane-2,5-dione |
| InChIKey | JJTUDXZGHPGLLC-IPSUFKGASA-N |
| SMILES | [13CH3][C@H]1C(=O)O[C@H](C(=O)O1)[13CH3] |
Computed by PubChem (NCBI)