cas: 912563-45-2 — see every product listed under this CAS number, including other names
(3aα,5β,6aα)-tert-Butyl 5-hydroxyhexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate 98% (CAS 912563-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656014-100mg |
| cas | 912563-45-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 2717.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A656014 |
Tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (CAS 912563-45-2) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate. InChIKey: DIDQRACXWWEPDZ-ULKQDVFKSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (3aR,6aS)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | DIDQRACXWWEPDZ-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(C[C@H]2C1)O |
Computed by PubChem (NCBI)