(3aR,3a'R,8aS,8a'S)-2,2'-(2,3-Dihydro-1H-indene-2,2-diyl)bis(3a,8a-dihydro-8H-indeno[1,2-d]oxazole), 95%
cas: 2757082-16-7 — see every product listed under this CAS number, including other names
(3aR,3a'R,8aS,8a'S)-2,2'-(2,3-Dihydro-1H-indene-2,2-diyl)bis(3a,8a-dihydro-8H-indeno[1,2-d]oxazole), 95% (CAS 2757082-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XDC2-100mg |
| cas | 2757082-16-7 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 1058.00 Pln | |
| Chemat | 5g | 4989.20 Pln | |
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 1434.93 Pln | |
| Fluorochem | 5g | 6646.64 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3aS,8bR)-2-[2-[(3aS,8bR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]-1,3-dihydroinden-2-yl]-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole (CAS 2757082-16-7) is a chemical compound with the molecular formula C29H24N2O2 and a molecular weight of 432.5 g/mol. IUPAC name: (3aS,8bR)-2-[2-[(3aS,8bR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]-1,3-dihydroinden-2-yl]-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole. InChIKey: SOHREFRGDMMLGD-QEGGNFSNSA-N.
| Molecular formula | C29H24N2O2 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (3aS,8bR)-2-[2-[(3aS,8bR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]-1,3-dihydroinden-2-yl]-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole |
| InChIKey | SOHREFRGDMMLGD-QEGGNFSNSA-N |
| SMILES | C1[C@H]2[C@@H](C3=CC=CC=C31)N=C(O2)C4(CC5=CC=CC=C5C4)C6=N[C@H]7[C@@H](O6)CC8=CC=CC=C78 |
Computed by PubChem (NCBI)