cas: 155899-66-4 — see every product listed under this CAS number, including other names
(3aR,4S,6R,6aS)-6-Aminotetrahydro-2,2-dimethyl-4H-cyclopenta-1,3-dioxol-4-ol, 98%, 98% (CAS 155899-66-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OBB-250mg |
| cas | 155899-66-4 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 486.80 Pln | |
| Chemat | 50g | 352.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (CAS 155899-66-4) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: (3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol. InChIKey: AXPYGRDXRLICKY-JRTVQGFMSA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| InChIKey | AXPYGRDXRLICKY-JRTVQGFMSA-N |
| SMILES | CC1(O[C@H]2[C@@H](C[C@@H]([C@H]2O1)O)N)C |
Computed by PubChem (NCBI)