cas: 155899-66-4 — see every product listed under this CAS number, including other names
Ticagrelor Related Compound 1 97% (CAS 155899-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199601-1g |
| cas | 155899-66-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 264.69 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 748.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A199601 |
(3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol (CAS 155899-66-4) is a chemical compound with the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. IUPAC name: (3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol. InChIKey: AXPYGRDXRLICKY-JRTVQGFMSA-N.
| Molecular formula | C8H15NO3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | (3aR,4S,6R,6aS)-6-amino-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-ol |
| InChIKey | AXPYGRDXRLICKY-JRTVQGFMSA-N |
| SMILES | CC1(O[C@H]2[C@@H](C[C@@H]([C@H]2O1)O)N)C |
Computed by PubChem (NCBI)