cas: 60277-22-7 — see every product listed under this CAS number, including other names
(4'-Methoxy-biphenyl-4-yl)-acetic acid, 98% (CAS 60277-22-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011465-100MG |
| cas | 60277-22-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 1013.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(4-methoxyphenyl)phenyl]acetic acid (CAS 60277-22-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-[4-(4-methoxyphenyl)phenyl]acetic acid. InChIKey: KJOHEDXEFMKOEF-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-[4-(4-methoxyphenyl)phenyl]acetic acid |
| InChIKey | KJOHEDXEFMKOEF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)