CAS 60277-22-7 appears in our catalog under these names: [4-(4-Methoxyphenyl)phenyl]acetic acid, 98%, (4'-Methoxy-biphenyl-4-yl)-acetic acid, (4'-Methoxy-biphenyl-4-yl)-acetic acid 98%, 2-(4'-Methoxy-[1,1'-biphenyl]-4-yl)acetic acid, 98%, 98%, (4'-Methoxy-biphenyl-4-yl)-acetic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[4-(4-methoxyphenyl)phenyl]acetic acid (CAS 60277-22-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-[4-(4-methoxyphenyl)phenyl]acetic acid. InChIKey: KJOHEDXEFMKOEF-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-[4-(4-methoxyphenyl)phenyl]acetic acid |
| InChIKey | KJOHEDXEFMKOEF-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)