cas: 1072951-98-4 — see every product listed under this CAS number, including other names
(4-((3-Fluorobenzyl)oxy)phenyl)boronic acid (CAS 1072951-98-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691543-250MG |
| cas | 1072951-98-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 664.37 Pln | |
| Fluorochem | 1g | 1278.73 Pln | |
| Fluorochem | 5g | 3387.37 Pln |
| delivery time | 3-4 weeks |
|---|
[4-[(3-fluorophenyl)methoxy]phenyl]boronic acid (CAS 1072951-98-4) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: [4-[(3-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: HLPBNLKHBWJWNP-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | [4-[(3-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | HLPBNLKHBWJWNP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC(=CC=C2)F)(O)O |
Computed by PubChem (NCBI)