(4-((3-Fluorophenyl)carbamoyl)phenyl)boronic acid, 98%(LC-MS),RG, 98%(LC-MS),RG
cas: 874288-05-8 — see every product listed under this CAS number, including other names
(4-((3-Fluorophenyl)carbamoyl)phenyl)boronic acid, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 874288-05-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115J1B-250mg |
| cas | 874288-05-8 |
| size | 250mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 25g | 1062.80 Pln | |
| Chemat | 100g | 4005.20 Pln |
properties
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
[4-[(3-fluorophenyl)carbamoyl]phenyl]boronic acid (CAS 874288-05-8) is a chemical compound with the molecular formula C13H11BFNO3 and a molecular weight of 259.04 g/mol. IUPAC name: [4-[(3-fluorophenyl)carbamoyl]phenyl]boronic acid. InChIKey: CVYDMRNYGKMSDI-UHFFFAOYSA-N.
| Molecular formula | C13H11BFNO3 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | [4-[(3-fluorophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | CVYDMRNYGKMSDI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC(=CC=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-((3-Fluorophenyl)carbamoyl)phenyl)boronic acid, 4-(3-Fluorophenylcarbamoyl)phenylboronic acid, N-3-Fluorophenyl 4-boronobenzamide, [4-[(3-fluorophenyl)carbamoyl]phenyl]boronic acid, {4-[(3-Fluorophenyl)carbamoyl]phenyl}boronic acid, 4-[(3-Fluorophenyl)carbamoyl]benzeneboronic acid, 4-Borono-N-(3-fluorophenyl)benzamide, 4-Borono-N-(, (4-((3-Fluorophenyl)carbamoyl)phenyl)boronicacid