CAS 1258236-58-6 appears in our catalog under these names: B-[3-[(4-Fluorobenzoyl)amino]phenyl]boronic acid, 97%, 3–(4–Fluorophenylformamide) phenylboronic acid, (3-(4-Fluorobenzamido)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
[3-[(4-fluorobenzoyl)amino]phenyl]boronic acid (CAS 1258236-58-6) is a chemical compound with the molecular formula C13H11BFNO3 and a molecular weight of 259.04 g/mol. IUPAC name: [3-[(4-fluorobenzoyl)amino]phenyl]boronic acid. InChIKey: JRQIAQFQFHCYOH-UHFFFAOYSA-N.
| Molecular formula | C13H11BFNO3 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | [3-[(4-fluorobenzoyl)amino]phenyl]boronic acid |
| InChIKey | JRQIAQFQFHCYOH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)