CAS 874289-41-5 appears in our catalog under these names: N-Phenyl 3-borono-4-fluorobenzamide, 98%, (2-Fluoro-5-(phenylcarbamoyl)phenyl)boronic acid 98%, N-Phenyl 3-borono-4-fluorobenzamide, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
[2-fluoro-5-(phenylcarbamoyl)phenyl]boronic acid (CAS 874289-41-5) is a chemical compound with the molecular formula C13H11BFNO3 and a molecular weight of 259.04 g/mol. IUPAC name: [2-fluoro-5-(phenylcarbamoyl)phenyl]boronic acid. InChIKey: KNJJUAJHTJOKIU-UHFFFAOYSA-N.
| Molecular formula | C13H11BFNO3 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | [2-fluoro-5-(phenylcarbamoyl)phenyl]boronic acid |
| InChIKey | KNJJUAJHTJOKIU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)