cas: 849052-25-1 — see every product listed under this CAS number, including other names
(4-((4-Chloro-3-methylphenoxy)methyl)phenyl)boronic acid, 98% (CAS 849052-25-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691534-250MG |
| cas | 849052-25-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 1065.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid (CAS 849052-25-1) is a chemical compound with the molecular formula C14H14BClO3 and a molecular weight of 276.52 g/mol. IUPAC name: [4-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid. InChIKey: OUKUADBAEFEIGP-UHFFFAOYSA-N.
| Molecular formula | C14H14BClO3 |
|---|---|
| Molecular weight | 276.52 g/mol |
| IUPAC name | [4-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid |
| InChIKey | OUKUADBAEFEIGP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2=CC(=C(C=C2)Cl)C)(O)O |
Computed by PubChem (NCBI)