CAS 849052-25-1 appears in our catalog under these names: 4-((4'-Chloro-3'-methylphenoxy)methyl)phenylboronic acid, 98%, 4-((4'-CHLORO-3'-METHYLPHENOXY)METHYL)PHENYLBORONIC ACID, 98%, 98%, (4-((4-Chloro-3-methylphenoxy)methyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
[4-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid (CAS 849052-25-1) is a chemical compound with the molecular formula C14H14BClO3 and a molecular weight of 276.52 g/mol. IUPAC name: [4-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid. InChIKey: OUKUADBAEFEIGP-UHFFFAOYSA-N.
| Molecular formula | C14H14BClO3 |
|---|---|
| Molecular weight | 276.52 g/mol |
| IUPAC name | [4-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid |
| InChIKey | OUKUADBAEFEIGP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2=CC(=C(C=C2)Cl)C)(O)O |
Computed by PubChem (NCBI)