CAS 1072951-91-7 appears in our catalog under these names: 3-[(4-Chloro-3-methylphenoxy)methyl]phenylboronic acid, 95%, 3-[(4-Chloro-3-methylphenoxy)methyl]phenylboronic acid, 95%, 95%, 3-[(4-Chloro-3-methylphenoxy)methyl]phenylboronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
[3-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid (CAS 1072951-91-7) is a chemical compound with the molecular formula C14H14BClO3 and a molecular weight of 276.52 g/mol. IUPAC name: [3-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid. InChIKey: MLTCJWUQGYLPLF-UHFFFAOYSA-N.
| Molecular formula | C14H14BClO3 |
|---|---|
| Molecular weight | 276.52 g/mol |
| IUPAC name | [3-[(4-chloro-3-methylphenoxy)methyl]phenyl]boronic acid |
| InChIKey | MLTCJWUQGYLPLF-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=CC(=C(C=C2)Cl)C)(O)O |
Computed by PubChem (NCBI)