cas: 850568-27-3 — see every product listed under this CAS number, including other names
(4-((4-Fluorophenyl)carbamoyl)phenyl)boronic acid, 95%, 95% (CAS 850568-27-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115SI7-1g |
| cas | 850568-27-3 |
| size | 1g |
| availability | 17.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-[(4-fluorophenyl)carbamoyl]phenyl]boronic acid (CAS 850568-27-3) is a chemical compound with the molecular formula C13H11BFNO3 and a molecular weight of 259.04 g/mol. IUPAC name: [4-[(4-fluorophenyl)carbamoyl]phenyl]boronic acid. InChIKey: HIHZUEQBMMAFSA-UHFFFAOYSA-N.
| Molecular formula | C13H11BFNO3 |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | [4-[(4-fluorophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | HIHZUEQBMMAFSA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)