cas: 690957-44-9 — see every product listed under this CAS number, including other names
(4-((Phenylamino)Methyl)Phenyl)Boronic Acid, 98%, 98% (CAS 690957-44-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116L98-250mg |
| cas | 690957-44-9 |
| size | 250mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(anilinomethyl)phenyl]boronic acid (CAS 690957-44-9) is a chemical compound with the molecular formula C13H14BNO2 and a molecular weight of 227.07 g/mol. IUPAC name: [4-(anilinomethyl)phenyl]boronic acid. InChIKey: FHQIDGWZDOKKDI-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO2 |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | [4-(anilinomethyl)phenyl]boronic acid |
| InChIKey | FHQIDGWZDOKKDI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)