CAS 690957-43-8 appears in our catalog under these names: 3-((Phenylamino)methyl)phenylboronic acid, 97%, (3-((Phenylamino)methyl)phenyl)boronic acid, 98%, (3–((Phenylamino)methyl)phenyl)boronic acid, (3-((Phenylamino)methyl)phenyl)boronic acid, 95%, 95%, (3-((Phenylamino)methyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[3-(anilinomethyl)phenyl]boronic acid (CAS 690957-43-8) is a chemical compound with the molecular formula C13H14BNO2 and a molecular weight of 227.07 g/mol. IUPAC name: [3-(anilinomethyl)phenyl]boronic acid. InChIKey: YUCBQVDRMDKWEH-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO2 |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | [3-(anilinomethyl)phenyl]boronic acid |
| InChIKey | YUCBQVDRMDKWEH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CNC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)