CAS 690957-44-9 appears in our catalog under these names: 4-((Phenylamino)methyl)phenylboronic acid, 97%, (4–((Phenylamino)methyl)phenyl)boronic acid, (4-((Phenylamino)methyl)phenyl)boronic acid 98%, (4-((Phenylamino)Methyl)Phenyl)Boronic Acid, 98%, 98%, (4-((Phenylamino)methyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[4-(anilinomethyl)phenyl]boronic acid (CAS 690957-44-9) is a chemical compound with the molecular formula C13H14BNO2 and a molecular weight of 227.07 g/mol. IUPAC name: [4-(anilinomethyl)phenyl]boronic acid. InChIKey: FHQIDGWZDOKKDI-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO2 |
|---|---|
| Molecular weight | 227.07 g/mol |
| IUPAC name | [4-(anilinomethyl)phenyl]boronic acid |
| InChIKey | FHQIDGWZDOKKDI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)