cas: 218301-87-2 — see every product listed under this CAS number, including other names
(4-((tert-butoxycarbonyl)amino)-3-fluorophenyl)boronic acid, 98% (CAS 218301-87-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F983548-500MG |
| cas | 218301-87-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 310.33 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 1034.03 Pln | |
| Fluorochem | 25g | 4949.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 218301-87-2) is a chemical compound with the molecular formula C11H15BFNO4 and a molecular weight of 255.05 g/mol. IUPAC name: [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: KZDXWWVPJSNDSD-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO4 |
|---|---|
| Molecular weight | 255.05 g/mol |
| IUPAC name | [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | KZDXWWVPJSNDSD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)NC(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)