cas: 218301-87-2 — see every product listed under this CAS number, including other names
4-N-Boc-amino-3-fluorophenylboronic acid, 98%, 98% (CAS 218301-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118P3W-100mg |
| cas | 218301-87-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 856.40 Pln | |
| Chemat | 10g | 1389.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 218301-87-2) is a chemical compound with the molecular formula C11H15BFNO4 and a molecular weight of 255.05 g/mol. IUPAC name: [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: KZDXWWVPJSNDSD-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO4 |
|---|---|
| Molecular weight | 255.05 g/mol |
| IUPAC name | [3-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | KZDXWWVPJSNDSD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)NC(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)