cas: 1686102-84-0 — see every product listed under this CAS number, including other names
(4-(4-(Trifluoromethoxy)phenoxy)phenyl)methanol 97% (CAS 1686102-84-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A511942-100mg |
| cas | 1686102-84-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2072.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A511942 |
[4-[4-(trifluoromethoxy)phenoxy]phenyl]methanol (CAS 1686102-84-0) is a chemical compound with the molecular formula C14H11F3O3 and a molecular weight of 284.23 g/mol. IUPAC name: [4-[4-(trifluoromethoxy)phenoxy]phenyl]methanol. InChIKey: YPVVIPKSYPCELD-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O3 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | [4-[4-(trifluoromethoxy)phenoxy]phenyl]methanol |
| InChIKey | YPVVIPKSYPCELD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)OC2=CC=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)