CAS 1881293-37-3 is the registry number for 3-(benzyloxy)-5-(trifluoromethoxy)phenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
3-phenylmethoxy-5-(trifluoromethoxy)phenol (CAS 1881293-37-3) is a chemical compound with the molecular formula C14H11F3O3 and a molecular weight of 284.23 g/mol. IUPAC name: 3-phenylmethoxy-5-(trifluoromethoxy)phenol. InChIKey: ILPATPFGRIYDFQ-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O3 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 3-phenylmethoxy-5-(trifluoromethoxy)phenol |
| InChIKey | ILPATPFGRIYDFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)O)OC(F)(F)F |
Computed by PubChem (NCBI)