CAS 853310-21-1 appears in our catalog under these names: 3-(5-(2-(Trifluoromethyl)phenyl)furan-2-yl)propionic acid, 95%, 3-(5-(2-(Trifluoromethyl)phenyl)furan-2-yl)propanoic acid, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 1g, on request.
3-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid (CAS 853310-21-1) is a chemical compound with the molecular formula C14H11F3O3 and a molecular weight of 284.23 g/mol. IUPAC name: 3-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid. InChIKey: GUNVLEJSOWBDBS-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O3 |
|---|---|
| Molecular weight | 284.23 g/mol |
| IUPAC name | 3-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid |
| InChIKey | GUNVLEJSOWBDBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)CCC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)