cas: 156837-90-0 — see every product listed under this CAS number, including other names
(4-(4-Propylcyclohexyl)phenyl)boronic acid, 98% (CAS 156837-90-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F054034-5G |
| cas | 156837-90-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 237.43 Pln | |
| Fluorochem | 25g | 414.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-(4-propylcyclohexyl)phenyl]boronic acid (CAS 156837-90-0) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: [4-(4-propylcyclohexyl)phenyl]boronic acid. InChIKey: QTBUVZSHCNAPRT-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | [4-(4-propylcyclohexyl)phenyl]boronic acid |
| InChIKey | QTBUVZSHCNAPRT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CCC(CC2)CCC)(O)O |
Computed by PubChem (NCBI)