CAS 1310048-99-7 appears in our catalog under these names: 2-[(2,6-Dimethylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 2-(2,6-Dimethylbenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g, 10g.
2-[(2,6-dimethylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1310048-99-7) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 2-[(2,6-dimethylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GHMGVDLXBXCTKK-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 2-[(2,6-dimethylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GHMGVDLXBXCTKK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)