CAS 329685-40-7 appears in our catalog under these names: 3-Phenyl-1-propylboronic acid pinacol ester, 95%, 3-Phenyl-1-propylboronic acid pinacol ester, 97% , 3-Phenyl-1-propylboronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(3-phenylpropyl)-1,3,2-dioxaborolane 98%, 3-Phenyl-1-propylboronic acid pinacol ester, ≥97%, ≥97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 2,5g, 250mg, 100mg.
4,4,5,5-tetramethyl-2-(3-phenylpropyl)-1,3,2-dioxaborolane (CAS 329685-40-7) is a chemical compound with the molecular formula C15H23BO2 and a molecular weight of 246.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-phenylpropyl)-1,3,2-dioxaborolane. InChIKey: HRZOKAQQKKQUME-UHFFFAOYSA-N.
| Molecular formula | C15H23BO2 |
|---|---|
| Molecular weight | 246.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-phenylpropyl)-1,3,2-dioxaborolane |
| InChIKey | HRZOKAQQKKQUME-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)