cas: 536974-94-4 — see every product listed under this CAS number, including other names
(4-(BENZYLOXY)-3-FLUOROPHENYL)METHANOL (CAS 536974-94-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F301292-1G |
| cas | 536974-94-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1060.06 Pln | |
| Fluorochem | 5g | 3028.12 Pln |
| delivery time | 3-4 weeks |
|---|
(3-fluoro-4-phenylmethoxyphenyl)methanol (CAS 536974-94-4) is a chemical compound with the molecular formula C14H13FO2 and a molecular weight of 232.25 g/mol. IUPAC name: (3-fluoro-4-phenylmethoxyphenyl)methanol. InChIKey: HWGIEIDBXWBVEB-UHFFFAOYSA-N.
| Molecular formula | C14H13FO2 |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | (3-fluoro-4-phenylmethoxyphenyl)methanol |
| InChIKey | HWGIEIDBXWBVEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)CO)F |
Computed by PubChem (NCBI)