Products 406482-29-9
CAS 406482-29-9 appears in our catalog under these names: 2-Fluoro-4',5-dimethoxy-1,1'-biphenyl, 95%, 2-Fluoro-4',5-dimethoxy-1,1'-biphenyl. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-fluoro-4-methoxy-2-(4-methoxyphenyl)benzene (CAS 406482-29-9) is a chemical compound with the molecular formula C14H13FO2 and a molecular weight of 232.25 g/mol. IUPAC name: 1-fluoro-4-methoxy-2-(4-methoxyphenyl)benzene. InChIKey: HULRXONRAHDIFN-UHFFFAOYSA-N.
| Molecular formula | C14H13FO2 |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | 1-fluoro-4-methoxy-2-(4-methoxyphenyl)benzene |
| InChIKey | HULRXONRAHDIFN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=CC(=C2)OC)F |
Computed by PubChem (NCBI)