CAS 331729-56-7 is the registry number for (2-(Benzyloxy)-5-fluorophenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(5-fluoro-2-phenylmethoxyphenyl)methanol (CAS 331729-56-7) is a chemical compound with the molecular formula C14H13FO2 and a molecular weight of 232.25 g/mol. IUPAC name: (5-fluoro-2-phenylmethoxyphenyl)methanol. InChIKey: SVAYSCAGXCLFKE-UHFFFAOYSA-N.
| Molecular formula | C14H13FO2 |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | (5-fluoro-2-phenylmethoxyphenyl)methanol |
| InChIKey | SVAYSCAGXCLFKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)F)CO |
Computed by PubChem (NCBI)